2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid

C10H8N2O3 — CID 68785258

IUPAC2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid
SMILESO=C(O)Cn1c(=O)ccc2cnccc21
InChIInChI=1S/C10H8N2O3/c13-9-2-1-7-5-11-4-3-8(7)12(9)6-10(14)15/h1-5H,6H2,(H,14,15)
InChIKeyXQZCXNMVBZCEEW-UHFFFAOYSA-N
MW204.19 g/mol
LogP0.48
Rot. Bonds2

About 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid

2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid (PubChem CID 68785258) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid
PubChem CID68785258
Molecular FormulaC10H8N2O3
Molecular Weight204.19 g/mol
Exact Mass204.05
IUPAC Name2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid
SMILESO=C(O)Cn1c(=O)ccc2cnccc21
InChIInChI=1S/C10H8N2O3/c13-9-2-1-7-5-11-4-3-8(7)12(9)6-10(14)15/h1-5H,6H2,(H,14,15)
InChIKeyXQZCXNMVBZCEEW-UHFFFAOYSA-N
XLogP0.48
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.19
LogP ≤ 50.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid?
The IUPAC name of 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid (CID 68785258) is 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid.
What is the SMILES notation for 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid?
The canonical SMILES for 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid is O=C(O)Cn1c(=O)ccc2cnccc21.
What is the InChIKey of 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid?
The InChIKey is XQZCXNMVBZCEEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c13-9-2-1-7-5-11-4-3-8(7)12(9)6-10(14)15/h1-5H,6H2,(H,14,15).
What are the key properties of 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid?
2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid has a molecular weight of 204.19 g/mol, XLogP of 0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-1,6-naphthyridin-1-yl)acetic acid is sourced from PubChem (CID 68785258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).