C10H13N3 — CID 117224025
1-pyrrolo[3,2-c]pyridin-1-ylpropan-2-amine (PubChem CID 117224025) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 1-pyrrolo[3,2-c]pyridin-1-ylpropan-2-amine.
| Compound Name | 1-pyrrolo[3,2-c]pyridin-1-ylpropan-2-amine |
|---|---|
| PubChem CID | 117224025 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-pyrrolo[3,2-c]pyridin-1-ylpropan-2-amine |
| SMILES | CC(N)Cn1ccc2cnccc21 |
| InChI | InChI=1S/C10H13N3/c1-8(11)7-13-5-3-9-6-12-4-2-10(9)13/h2-6,8H,7,11H2,1H3 |
| InChIKey | QKCQJEVCLBHGTM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |