C8H5ClN2O — CID 154368261
1-chloro-1,8-naphthyridin-2-one (PubChem CID 154368261) has the molecular formula C8H5ClN2O and a molecular weight of 180.59 g/mol. Its IUPAC name is 1-chloro-1,8-naphthyridin-2-one.
| Compound Name | 1-chloro-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 154368261 |
| Molecular Formula | C8H5ClN2O |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.01 |
| IUPAC Name | 1-chloro-1,8-naphthyridin-2-one |
| SMILES | O=c1ccc2cccnc2n1Cl |
| InChI | InChI=1S/C8H5ClN2O/c9-11-7(12)4-3-6-2-1-5-10-8(6)11/h1-5H |
| InChIKey | BNCCFSHGLBHIIT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |