C9H12N2 — CID 142434166
methane;1-methylpyrrolo[2,3-b]pyridine (PubChem CID 142434166) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is methane;1-methylpyrrolo[2,3-b]pyridine.
| Compound Name | methane;1-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 142434166 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | methane;1-methylpyrrolo[2,3-b]pyridine |
| SMILES | C.Cn1ccc2cccnc21 |
| InChI | InChI=1S/C8H8N2.CH4/c1-10-6-4-7-3-2-5-9-8(7)10;/h2-6H,1H3;1H4 |
| InChIKey | XFDCDQDUBOIWDB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |