C17H22N2 — CID 143220810
ethane;1-methylpyrrolo[2,3-b]pyridine;toluene (PubChem CID 143220810) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is ethane;1-methylpyrrolo[2,3-b]pyridine;toluene.
| Compound Name | ethane;1-methylpyrrolo[2,3-b]pyridine;toluene |
|---|---|
| PubChem CID | 143220810 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | ethane;1-methylpyrrolo[2,3-b]pyridine;toluene |
| SMILES | CC.Cc1ccccc1.Cn1ccc2cccnc21 |
| InChI | InChI=1S/C8H8N2.C7H8.C2H6/c1-10-6-4-7-3-2-5-9-8(7)10;1-7-5-3-2-4-6-7;1-2/h2-6H,1H3;2-6H,1H3;1-2H3 |
| InChIKey | ANSWWLJWNKNDTL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |