C12H14N2 — CID 175838520
1-pent-4-enylpyrrolo[2,3-b]pyridine (PubChem CID 175838520) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 1-pent-4-enylpyrrolo[2,3-b]pyridine.
| Compound Name | 1-pent-4-enylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 175838520 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-pent-4-enylpyrrolo[2,3-b]pyridine |
| SMILES | C=CCCCn1ccc2cccnc21 |
| InChI | InChI=1S/C12H14N2/c1-2-3-4-9-14-10-7-11-6-5-8-13-12(11)14/h2,5-8,10H,1,3-4,9H2 |
| InChIKey | TYJMMDUAYYOTIY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|