C19H18N4O2S — CID 90556457
N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)quinoline-8-sulfonamide (PubChem CID 90556457) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)quinoline-8-sulfonamide.
| Compound Name | N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 90556457 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-(3-pyrrolo[2,3-b]pyridin-1-ylpropyl)quinoline-8-sulfonamide |
| SMILES | O=S(=O)(NCCCn1ccc2cccnc21)c1cccc2cccnc12 |
| InChI | InChI=1S/C19H18N4O2S/c24-26(25,17-8-1-5-15-6-2-10-20-18(15)17)22-12-4-13-23-14-9-16-7-3-11-21-19(16)23/h1-3,5-11,14,22H,4,12-13H2 |
| InChIKey | ONMHNRZHUGABCK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|