C24H29N3O4S — CID 21092409
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide (PubChem CID 21092409) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 21092409 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]quinoline-8-sulfonamide |
| SMILES | COc1cc2c(cc1OC)CN(CCCCNS(=O)(=O)c1cccc3cccnc13)CC2 |
| InChI | InChI=1S/C24H29N3O4S/c1-30-21-15-19-10-14-27(17-20(19)16-22(21)31-2)13-4-3-12-26-32(28,29)23-9-5-7-18-8-6-11-25-24(18)23/h5-9,11,15-16,26H,3-4,10,12-14,17H2,1-2H3 |
| InChIKey | VXVRNDWUPWTGKT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|