C22H29ClF2N2O4S — CID 21092389
N-[5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-2,6-difluorobenzenesulfonamide;hydrochloride (PubChem CID 21092389) has the molecular formula C22H29ClF2N2O4S and a molecular weight of 491.00 g/mol. Its IUPAC name is N-[5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-2,6-difluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-[5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-2,6-difluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 21092389 |
| Molecular Formula | C22H29ClF2N2O4S |
| Molecular Weight | 491.00 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N-[5-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)pentyl]-2,6-difluorobenzenesulfonamide;hydrochloride |
| SMILES | COc1cc2c(cc1OC)CN(CCCCCNS(=O)(=O)c1c(F)cccc1F)CC2.Cl |
| InChI | InChI=1S/C22H28F2N2O4S.ClH/c1-29-20-13-16-9-12-26(15-17(16)14-21(20)30-2)11-5-3-4-10-25-31(27,28)22-18(23)7-6-8-19(22)24;/h6-8,13-14,25H,3-5,9-12,15H2,1-2H3;1H |
| InChIKey | TZTZTCRAVFBKJZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.00 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|