C21H26F2N2O4S — CID 21092296
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,4-difluorobenzenesulfonamide (PubChem CID 21092296) has the molecular formula C21H26F2N2O4S and a molecular weight of 440.51 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 21092296 |
| Molecular Formula | C21H26F2N2O4S |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-2,4-difluorobenzenesulfonamide |
| SMILES | COc1cc2c(cc1OC)CN(CCCCNS(=O)(=O)c1ccc(F)cc1F)CC2 |
| InChI | InChI=1S/C21H26F2N2O4S/c1-28-19-11-15-7-10-25(14-16(15)12-20(19)29-2)9-4-3-8-24-30(26,27)21-6-5-17(22)13-18(21)23/h5-6,11-13,24H,3-4,7-10,14H2,1-2H3 |
| InChIKey | YWJMTNGADWOWKL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|