C20H24F2N2O4S — CID 21091921
N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2,5-difluorobenzenesulfonamide (PubChem CID 21091921) has the molecular formula C20H24F2N2O4S and a molecular weight of 426.49 g/mol. Its IUPAC name is N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2,5-difluorobenzenesulfonamide.
| Compound Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 21091921 |
| Molecular Formula | C20H24F2N2O4S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-2,5-difluorobenzenesulfonamide |
| SMILES | COc1cc2c(cc1OC)CN(CCCNS(=O)(=O)c1cc(F)ccc1F)CC2 |
| InChI | InChI=1S/C20H24F2N2O4S/c1-27-18-10-14-6-9-24(13-15(14)11-19(18)28-2)8-3-7-23-29(25,26)20-12-16(21)4-5-17(20)22/h4-5,10-12,23H,3,6-9,13H2,1-2H3 |
| InChIKey | PYZIIKXHWGACTN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|