C21H26ClF3N2O5S — CID 21091956
N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(trifluoromethoxy)benzenesulfonamide;hydrochloride (PubChem CID 21091956) has the molecular formula C21H26ClF3N2O5S and a molecular weight of 510.96 g/mol. Its IUPAC name is N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(trifluoromethoxy)benzenesulfonamide;hydrochloride.
| Compound Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(trifluoromethoxy)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 21091956 |
| Molecular Formula | C21H26ClF3N2O5S |
| Molecular Weight | 510.96 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-(trifluoromethoxy)benzenesulfonamide;hydrochloride |
| SMILES | COc1cc2c(cc1OC)CN(CCCNS(=O)(=O)c1ccc(OC(F)(F)F)cc1)CC2.Cl |
| InChI | InChI=1S/C21H25F3N2O5S.ClH/c1-29-19-12-15-8-11-26(14-16(15)13-20(19)30-2)10-3-9-25-32(27,28)18-6-4-17(5-7-18)31-21(22,23)24;/h4-7,12-13,25H,3,8-11,14H2,1-2H3;1H |
| InChIKey | XJCPTJLYTOZMBZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.96 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|