C20H25Cl2FN2O4S — CID 21091804
3-chloro-N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-fluorobenzenesulfonamide;hydrochloride (PubChem CID 21091804) has the molecular formula C20H25Cl2FN2O4S and a molecular weight of 479.40 g/mol. Its IUPAC name is 3-chloro-N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | 3-chloro-N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 21091804 |
| Molecular Formula | C20H25Cl2FN2O4S |
| Molecular Weight | 479.40 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 3-chloro-N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]-4-fluorobenzenesulfonamide;hydrochloride |
| SMILES | COc1cc2c(cc1OC)CN(CCCNS(=O)(=O)c1ccc(F)c(Cl)c1)CC2.Cl |
| InChI | InChI=1S/C20H24ClFN2O4S.ClH/c1-27-19-10-14-6-9-24(13-15(14)11-20(19)28-2)8-3-7-23-29(25,26)16-4-5-18(22)17(21)12-16;/h4-5,10-12,23H,3,6-9,13H2,1-2H3;1H |
| InChIKey | CTPUNNWTNLMAHI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|