C20H26BrCl2N3O4S — CID 169425649
5-bromo-6-chloro-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]pyridine-3-sulfonamide;hydrochloride (PubChem CID 169425649) has the molecular formula C20H26BrCl2N3O4S and a molecular weight of 555.32 g/mol. Its IUPAC name is 5-bromo-6-chloro-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]pyridine-3-sulfonamide;hydrochloride.
| Compound Name | 5-bromo-6-chloro-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]pyridine-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 169425649 |
| Molecular Formula | C20H26BrCl2N3O4S |
| Molecular Weight | 555.32 g/mol |
| Exact Mass | 553.02 |
| IUPAC Name | 5-bromo-6-chloro-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]pyridine-3-sulfonamide;hydrochloride |
| SMILES | COc1cc2c(cc1OC)CN(CCCCNS(=O)(=O)c1cnc(Cl)c(Br)c1)CC2.Cl |
| InChI | InChI=1S/C20H25BrClN3O4S.ClH/c1-28-18-9-14-5-8-25(13-15(14)10-19(18)29-2)7-4-3-6-24-30(26,27)16-11-17(21)20(22)23-12-16;/h9-12,24H,3-8,13H2,1-2H3;1H |
| InChIKey | RLVXHJZGIMTBBR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|