C21H25ClF2N2O4S — CID 11547409
2-chloro-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-4,5-difluorobenzenesulfonamide (PubChem CID 11547409) has the molecular formula C21H25ClF2N2O4S and a molecular weight of 474.96 g/mol. Its IUPAC name is 2-chloro-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-4,5-difluorobenzenesulfonamide.
| Compound Name | 2-chloro-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-4,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 11547409 |
| Molecular Formula | C21H25ClF2N2O4S |
| Molecular Weight | 474.96 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 2-chloro-N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)butyl]-4,5-difluorobenzenesulfonamide |
| SMILES | COc1cc2c(cc1OC)CN(CCCCNS(=O)(=O)c1cc(F)c(F)cc1Cl)CC2 |
| InChI | InChI=1S/C21H25ClF2N2O4S/c1-29-19-9-14-5-8-26(13-15(14)10-20(19)30-2)7-4-3-6-25-31(27,28)21-12-18(24)17(23)11-16(21)22/h9-12,25H,3-8,13H2,1-2H3 |
| InChIKey | ZHUHFYORLRMOHI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.96 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|