C23H28ClN3O4S — CID 21091970
N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]quinoline-8-sulfonamide;hydrochloride (PubChem CID 21091970) has the molecular formula C23H28ClN3O4S and a molecular weight of 478.01 g/mol. Its IUPAC name is N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]quinoline-8-sulfonamide;hydrochloride.
| Compound Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]quinoline-8-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 21091970 |
| Molecular Formula | C23H28ClN3O4S |
| Molecular Weight | 478.01 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)propyl]quinoline-8-sulfonamide;hydrochloride |
| SMILES | COc1cc2c(cc1OC)CN(CCCNS(=O)(=O)c1cccc3cccnc13)CC2.Cl |
| InChI | InChI=1S/C23H27N3O4S.ClH/c1-29-20-14-18-9-13-26(16-19(18)15-21(20)30-2)12-5-11-25-31(27,28)22-8-3-6-17-7-4-10-24-23(17)22;/h3-4,6-8,10,14-15,25H,5,9,11-13,16H2,1-2H3;1H |
| InChIKey | LOWHSPUHBAATCS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.01 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|