C22H18N6Si — CID 139110626
methyl-tris(pyrrolo[2,3-b]pyridin-1-yl)silane (PubChem CID 139110626) has the molecular formula C22H18N6Si and a molecular weight of 394.51 g/mol. Its IUPAC name is methyl-tris(pyrrolo[2,3-b]pyridin-1-yl)silane.
| Compound Name | methyl-tris(pyrrolo[2,3-b]pyridin-1-yl)silane |
|---|---|
| PubChem CID | 139110626 |
| Molecular Formula | C22H18N6Si |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | methyl-tris(pyrrolo[2,3-b]pyridin-1-yl)silane |
| SMILES | C[Si](n1ccc2cccnc21)(n1ccc2cccnc21)n1ccc2cccnc21 |
| InChI | InChI=1S/C22H18N6Si/c1-29(26-14-8-17-5-2-11-23-20(17)26,27-15-9-18-6-3-12-24-21(18)27)28-16-10-19-7-4-13-25-22(19)28/h2-16H,1H3 |
| InChIKey | OBQWKLMRYKFKHW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|