C12H15N3O — CID 71112397
1-piperidin-4-yloxypyrrolo[2,3-b]pyridine (PubChem CID 71112397) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 1-piperidin-4-yloxypyrrolo[2,3-b]pyridine.
| Compound Name | 1-piperidin-4-yloxypyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 71112397 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1-piperidin-4-yloxypyrrolo[2,3-b]pyridine |
| SMILES | c1cnc2c(c1)ccn2OC1CCNCC1 |
| InChI | InChI=1S/C12H15N3O/c1-2-10-5-9-15(12(10)14-6-1)16-11-3-7-13-8-4-11/h1-2,5-6,9,11,13H,3-4,7-8H2 |
| InChIKey | FUURAANAYZHWEO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |