About methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium
methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium (PubChem CID 11454092) has the molecular formula C14H14Cl3N2ORuS
and a molecular weight of 465.78 g/mol. Its IUPAC name is methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium.
Molecular Properties
| Compound Name | methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium |
| PubChem CID | 11454092 |
| Molecular Formula | C14H14Cl3N2ORuS |
| Molecular Weight | 465.78 g/mol |
| Exact Mass | 464.89 |
| IUPAC Name | methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium |
| SMILES | CS(C)=O.Cl[Ru](Cl)Cl.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C2H6OS.3ClH.Ru/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-4(2)3;;;;/h1-8H;1-2H3;3*1H;/q;;;;;+3/p-3 |
| InChIKey | GTOJEOYCPCKNJM-UHFFFAOYSA-K |
| XLogP | 4.84 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.78 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium?
The IUPAC name of methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium (CID 11454092) is methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium.
What is the SMILES notation for methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium?
The canonical SMILES for methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium is CS(C)=O.Cl[Ru](Cl)Cl.c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium?
The InChIKey is GTOJEOYCPCKNJM-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H8N2.C2H6OS.3ClH.Ru/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-4(2)3;;;;/h1-8H;1-2H3;3*1H;/q;;;;;+3/p-3.
What are the key properties of methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium?
methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium has a molecular weight of 465.78 g/mol, XLogP of 4.84, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfinylmethane;1,10-phenanthroline;trichlororuthenium is sourced from PubChem (CID 11454092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).