C9H9N3O2 — CID 139622666
1-(hydroxymethylamino)-1,8-naphthyridin-2-one (PubChem CID 139622666) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 1-(hydroxymethylamino)-1,8-naphthyridin-2-one.
| Compound Name | 1-(hydroxymethylamino)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 139622666 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 1-(hydroxymethylamino)-1,8-naphthyridin-2-one |
| SMILES | O=c1ccc2cccnc2n1NCO |
| InChI | InChI=1S/C9H9N3O2/c13-6-11-12-8(14)4-3-7-2-1-5-10-9(7)12/h1-5,11,13H,6H2 |
| InChIKey | XALBSPBGEQDLDJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|