C10H11N3OS — CID 139622317
1-(1-hydroxyethylamino)-1,8-naphthyridine-2-thione (PubChem CID 139622317) has the molecular formula C10H11N3OS and a molecular weight of 221.29 g/mol. Its IUPAC name is 1-(1-hydroxyethylamino)-1,8-naphthyridine-2-thione.
| Compound Name | 1-(1-hydroxyethylamino)-1,8-naphthyridine-2-thione |
|---|---|
| PubChem CID | 139622317 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-(1-hydroxyethylamino)-1,8-naphthyridine-2-thione |
| SMILES | CC(O)Nn1c(=S)ccc2cccnc21 |
| InChI | InChI=1S/C10H11N3OS/c1-7(14)12-13-9(15)5-4-8-3-2-6-11-10(8)13/h2-7,12,14H,1H3 |
| InChIKey | XEYUORZQXSAAER-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|