C14H17N3S — CID 139622396
1-(cyclohexylamino)-1,8-naphthyridine-2-thione (PubChem CID 139622396) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 1-(cyclohexylamino)-1,8-naphthyridine-2-thione.
| Compound Name | 1-(cyclohexylamino)-1,8-naphthyridine-2-thione |
|---|---|
| PubChem CID | 139622396 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-(cyclohexylamino)-1,8-naphthyridine-2-thione |
| SMILES | S=c1ccc2cccnc2n1NC1CCCCC1 |
| InChI | InChI=1S/C14H17N3S/c18-13-9-8-11-5-4-10-15-14(11)17(13)16-12-6-2-1-3-7-12/h4-5,8-10,12,16H,1-3,6-7H2 |
| InChIKey | QGFNKDYRLKXPAM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|