C17H24N4O2S — CID 175644954
N-(4-pyrrolo[2,3-b]pyridin-1-ylcyclohexyl)pyrrolidine-1-sulfonamide (PubChem CID 175644954) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-(4-pyrrolo[2,3-b]pyridin-1-ylcyclohexyl)pyrrolidine-1-sulfonamide.
| Compound Name | N-(4-pyrrolo[2,3-b]pyridin-1-ylcyclohexyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 175644954 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-(4-pyrrolo[2,3-b]pyridin-1-ylcyclohexyl)pyrrolidine-1-sulfonamide |
| SMILES | O=S(=O)(NC1CCC(n2ccc3cccnc32)CC1)N1CCCC1 |
| InChI | InChI=1S/C17H24N4O2S/c22-24(23,20-11-1-2-12-20)19-15-5-7-16(8-6-15)21-13-9-14-4-3-10-18-17(14)21/h3-4,9-10,13,15-16,19H,1-2,5-8,11-12H2 |
| InChIKey | FTLNZOFPNZBBGB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |