C14H22N4O3S — CID 126934326
N-[4-(6-oxopyridazin-1-yl)cyclohexyl]pyrrolidine-1-sulfonamide (PubChem CID 126934326) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[4-(6-oxopyridazin-1-yl)cyclohexyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[4-(6-oxopyridazin-1-yl)cyclohexyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 126934326 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[4-(6-oxopyridazin-1-yl)cyclohexyl]pyrrolidine-1-sulfonamide |
| SMILES | O=c1cccnn1C1CCC(NS(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C14H22N4O3S/c19-14-4-3-9-15-18(14)13-7-5-12(6-8-13)16-22(20,21)17-10-1-2-11-17/h3-4,9,12-13,16H,1-2,5-8,10-11H2 |
| InChIKey | SNUBYNGRDHHRLB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |