C11H15N3O4S — CID 63654456
2-(piperidin-1-ylsulfonylamino)pyridine-3-carboxylic acid (PubChem CID 63654456) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(piperidin-1-ylsulfonylamino)pyridine-3-carboxylic acid.
| Compound Name | 2-(piperidin-1-ylsulfonylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63654456 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(piperidin-1-ylsulfonylamino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1NS(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C11H15N3O4S/c15-11(16)9-5-4-6-12-10(9)13-19(17,18)14-7-2-1-3-8-14/h4-6H,1-3,7-8H2,(H,12,13)(H,15,16) |
| InChIKey | LNPQWXLXNOIQCS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |