C15H11Cl2N3S — CID 139622393
1-[(2,6-dichlorophenyl)methylamino]-1,8-naphthyridine-2-thione (PubChem CID 139622393) has the molecular formula C15H11Cl2N3S and a molecular weight of 336.25 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methylamino]-1,8-naphthyridine-2-thione.
| Compound Name | 1-[(2,6-dichlorophenyl)methylamino]-1,8-naphthyridine-2-thione |
|---|---|
| PubChem CID | 139622393 |
| Molecular Formula | C15H11Cl2N3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methylamino]-1,8-naphthyridine-2-thione |
| SMILES | S=c1ccc2cccnc2n1NCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H11Cl2N3S/c16-12-4-1-5-13(17)11(12)9-19-20-14(21)7-6-10-3-2-8-18-15(10)20/h1-8,19H,9H2 |
| InChIKey | RKSMRUZRXRTGPE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|