C18H19N3S — CID 139622295
1-(benzylamino)-3-propyl-1,8-naphthyridine-2-thione (PubChem CID 139622295) has the molecular formula C18H19N3S and a molecular weight of 309.44 g/mol. Its IUPAC name is 1-(benzylamino)-3-propyl-1,8-naphthyridine-2-thione.
| Compound Name | 1-(benzylamino)-3-propyl-1,8-naphthyridine-2-thione |
|---|---|
| PubChem CID | 139622295 |
| Molecular Formula | C18H19N3S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 1-(benzylamino)-3-propyl-1,8-naphthyridine-2-thione |
| SMILES | CCCc1cc2cccnc2n(NCc2ccccc2)c1=S |
| InChI | InChI=1S/C18H19N3S/c1-2-7-16-12-15-10-6-11-19-17(15)21(18(16)22)20-13-14-8-4-3-5-9-14/h3-6,8-12,20H,2,7,13H2,1H3 |
| InChIKey | LKPUJFOTUCATIP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|