C12H16N2 — CID 142666149
2-butyl-1-methylpyrrolo[2,3-b]pyridine (PubChem CID 142666149) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-butyl-1-methylpyrrolo[2,3-b]pyridine.
| Compound Name | 2-butyl-1-methylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 142666149 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-butyl-1-methylpyrrolo[2,3-b]pyridine |
| SMILES | CCCCc1cc2cccnc2n1C |
| InChI | InChI=1S/C12H16N2/c1-3-4-7-11-9-10-6-5-8-13-12(10)14(11)2/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | QJEUTDMSBPAOQG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |