C10H11N3S — CID 139622625
1-(dimethylamino)-1,8-naphthyridine-2-thione (PubChem CID 139622625) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 1-(dimethylamino)-1,8-naphthyridine-2-thione.
| Compound Name | 1-(dimethylamino)-1,8-naphthyridine-2-thione |
|---|---|
| PubChem CID | 139622625 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 1-(dimethylamino)-1,8-naphthyridine-2-thione |
| SMILES | CN(C)n1c(=S)ccc2cccnc21 |
| InChI | InChI=1S/C10H11N3S/c1-12(2)13-9(14)6-5-8-4-3-7-11-10(8)13/h3-7H,1-2H3 |
| InChIKey | MSUQNOMGYUJFIN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|