C8H7N2O- — CID 142719673
2-methyl-1-oxidopyrrolo[2,3-b]pyridine (PubChem CID 142719673) has the molecular formula C8H7N2O- and a molecular weight of 147.16 g/mol. Its IUPAC name is 2-methyl-1-oxidopyrrolo[2,3-b]pyridine.
| Compound Name | 2-methyl-1-oxidopyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 142719673 |
| Molecular Formula | C8H7N2O- |
| Molecular Weight | 147.16 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | 2-methyl-1-oxidopyrrolo[2,3-b]pyridine |
| SMILES | Cc1cc2cccnc2n1[O-] |
| InChI | InChI=1S/C8H7N2O/c1-6-5-7-3-2-4-9-8(7)10(6)11/h2-5H,1H3/q-1 |
| InChIKey | MGBYDVHGYDANBP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 40.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.16 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|