About 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine
1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine (PubChem CID 170310746) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine |
| PubChem CID | 170310746 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine |
| SMILES | CC(C)n1c(N)cc2cccnc21 |
| InChI | InChI=1S/C10H13N3/c1-7(2)13-9(11)6-8-4-3-5-12-10(8)13/h3-7H,11H2,1-2H3 |
| InChIKey | ZTRYRQPYUGBREN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine?
The IUPAC name of 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine (CID 170310746) is 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine.
What is the SMILES notation for 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine?
The canonical SMILES for 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine is CC(C)n1c(N)cc2cccnc21.
What is the InChIKey of 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine?
The InChIKey is ZTRYRQPYUGBREN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-7(2)13-9(11)6-8-4-3-5-12-10(8)13/h3-7H,11H2,1-2H3.
What are the key properties of 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine?
1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine has a molecular weight of 175.24 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylpyrrolo[2,3-b]pyridin-2-amine is sourced from PubChem (CID 170310746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).