C11H13LiN2O — CID 156675221
lithium 1-tert-butylpyrrolo[2,3-b]pyridin-2-olate (PubChem CID 156675221) has the molecular formula C11H13LiN2O and a molecular weight of 196.18 g/mol. Its IUPAC name is lithium 1-tert-butylpyrrolo[2,3-b]pyridin-2-olate.
| Compound Name | lithium 1-tert-butylpyrrolo[2,3-b]pyridin-2-olate |
|---|---|
| PubChem CID | 156675221 |
| Molecular Formula | C11H13LiN2O |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | lithium 1-tert-butylpyrrolo[2,3-b]pyridin-2-olate |
| SMILES | CC(C)(C)n1c([O-])cc2cccnc21.[Li+] |
| InChI | InChI=1S/C11H14N2O.Li/c1-11(2,3)13-9(14)7-8-5-4-6-12-10(8)13;/h4-7,14H,1-3H3;/q;+1/p-1 |
| InChIKey | CSMBXXRQWMSKRJ-UHFFFAOYSA-M |
| XLogP | -1.13 |
| TPSA | 40.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |