C11H12ClN3O — CID 164662772
4-tert-butyl-2-chloropyrido[2,3-b]pyrazin-3-one (PubChem CID 164662772) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 4-tert-butyl-2-chloropyrido[2,3-b]pyrazin-3-one.
| Compound Name | 4-tert-butyl-2-chloropyrido[2,3-b]pyrazin-3-one |
|---|---|
| PubChem CID | 164662772 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4-tert-butyl-2-chloropyrido[2,3-b]pyrazin-3-one |
| SMILES | CC(C)(C)n1c(=O)c(Cl)nc2cccnc21 |
| InChI | InChI=1S/C11H12ClN3O/c1-11(2,3)15-9-7(5-4-6-13-9)14-8(12)10(15)16/h4-6H,1-3H3 |
| InChIKey | KCEFDLKYHLNZDN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |