C10H13N3O — CID 144894477
acetaldehyde;2,3-dimethylimidazo[4,5-b]pyridine (PubChem CID 144894477) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is acetaldehyde;2,3-dimethylimidazo[4,5-b]pyridine.
| Compound Name | acetaldehyde;2,3-dimethylimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 144894477 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | acetaldehyde;2,3-dimethylimidazo[4,5-b]pyridine |
| SMILES | CC=O.Cc1nc2cccnc2n1C |
| InChI | InChI=1S/C8H9N3.C2H4O/c1-6-10-7-4-3-5-9-8(7)11(6)2;1-2-3/h3-5H,1-2H3;2H,1H3 |
| InChIKey | HCBVRENZWPDNAA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|