C7H6N4O — CID 59061424
4-methylpyrido[2,3-e][1,2,4]triazin-3-one (PubChem CID 59061424) has the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. Its IUPAC name is 4-methylpyrido[2,3-e][1,2,4]triazin-3-one.
| Compound Name | 4-methylpyrido[2,3-e][1,2,4]triazin-3-one |
|---|---|
| PubChem CID | 59061424 |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 4-methylpyrido[2,3-e][1,2,4]triazin-3-one |
| SMILES | Cn1c(=O)nnc2cccnc21 |
| InChI | InChI=1S/C7H6N4O/c1-11-6-5(3-2-4-8-6)9-10-7(11)12/h2-4H,1H3 |
| InChIKey | PPGHGADRRMHWRK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |