C9H11N3 — CID 82415409
1,2-dimethylpyrrolo[2,3-b]pyridin-3-amine (PubChem CID 82415409) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 1,2-dimethylpyrrolo[2,3-b]pyridin-3-amine.
| Compound Name | 1,2-dimethylpyrrolo[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 82415409 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 1,2-dimethylpyrrolo[2,3-b]pyridin-3-amine |
| SMILES | Cc1c(N)c2cccnc2n1C |
| InChI | InChI=1S/C9H11N3/c1-6-8(10)7-4-3-5-11-9(7)12(6)2/h3-5H,10H2,1-2H3 |
| InChIKey | CHMAZORPXJXQDK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |