C19H30N2 — CID 171072564
ethane;9-methylpyrido[2,3-b]indole;propane (PubChem CID 171072564) has the molecular formula C19H30N2 and a molecular weight of 286.46 g/mol. Its IUPAC name is ethane;9-methylpyrido[2,3-b]indole;propane.
| Compound Name | ethane;9-methylpyrido[2,3-b]indole;propane |
|---|---|
| PubChem CID | 171072564 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | ethane;9-methylpyrido[2,3-b]indole;propane |
| SMILES | CC.CC.CCC.Cn1c2ccccc2c2cccnc21 |
| InChI | InChI=1S/C12H10N2.C3H8.2C2H6/c1-14-11-7-3-2-5-9(11)10-6-4-8-13-12(10)14;1-3-2;2*1-2/h2-8H,1H3;3H2,1-2H3;2*1-2H3 |
| InChIKey | NVMGOEHWHOHONP-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |