C11H13N3O2 — CID 146615670
1-methyl-3-propan-2-ylpyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 146615670) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-methyl-3-propan-2-ylpyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-methyl-3-propan-2-ylpyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 146615670 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-methyl-3-propan-2-ylpyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CC(C)n1c(=O)c2cccnc2n(C)c1=O |
| InChI | InChI=1S/C11H13N3O2/c1-7(2)14-10(15)8-5-4-6-12-9(8)13(3)11(14)16/h4-7H,1-3H3 |
| InChIKey | NXDOHZFKXNWEMJ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |