C12H16N4O3 — CID 134536405
1-methyl-3-[2-(methylaminooxy)propan-2-yl]pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 134536405) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-methyl-3-[2-(methylaminooxy)propan-2-yl]pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 1-methyl-3-[2-(methylaminooxy)propan-2-yl]pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134536405 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-methyl-3-[2-(methylaminooxy)propan-2-yl]pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | CNOC(C)(C)n1c(=O)c2cccnc2n(C)c1=O |
| InChI | InChI=1S/C12H16N4O3/c1-12(2,19-13-3)16-10(17)8-6-5-7-14-9(8)15(4)11(16)18/h5-7,13H,1-4H3 |
| InChIKey | SVYFKTBGMNDEKK-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|