C13H10N6O3 — CID 135513699
13,15-dimethyl-1,3,9,11,13,15-hexazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12(17)-pentaene-8,14,16-trione (PubChem CID 135513699) has the molecular formula C13H10N6O3 and a molecular weight of 298.26 g/mol. Its IUPAC name is 13,15-dimethyl-1,3,9,11,13,15-hexazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12(17)-pentaene-8,14,16-trione.
| Compound Name | 13,15-dimethyl-1,3,9,11,13,15-hexazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12(17)-pentaene-8,14,16-trione |
|---|---|
| PubChem CID | 135513699 |
| Molecular Formula | C13H10N6O3 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 13,15-dimethyl-1,3,9,11,13,15-hexazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),3,5,10,12(17)-pentaene-8,14,16-trione |
| SMILES | Cn1c(=O)c2c(nc3[nH]c(=O)c4cccnc4n32)n(C)c1=O |
| InChI | InChI=1S/C13H10N6O3/c1-17-9-7(11(21)18(2)13(17)22)19-8-6(4-3-5-14-8)10(20)16-12(19)15-9/h3-5H,1-2H3,(H,15,16,20) |
| InChIKey | AGZXBUNTWIWKKQ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 107.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |