C15H13N5O3 — CID 10267450
1,3,11-trimethylpurino[8,7-b]quinazoline-2,4,6-trione (PubChem CID 10267450) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is 1,3,11-trimethylpurino[8,7-b]quinazoline-2,4,6-trione.
| Compound Name | 1,3,11-trimethylpurino[8,7-b]quinazoline-2,4,6-trione |
|---|---|
| PubChem CID | 10267450 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1,3,11-trimethylpurino[8,7-b]quinazoline-2,4,6-trione |
| SMILES | Cn1c(=O)c2c(nc3n(C)c4ccccc4c(=O)n23)n(C)c1=O |
| InChI | InChI=1S/C15H13N5O3/c1-17-9-7-5-4-6-8(9)12(21)20-10-11(16-14(17)20)18(2)15(23)19(3)13(10)22/h4-7H,1-3H3 |
| InChIKey | IWRFDHCQUDMHNG-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |