C17H15N5NaO4 — CID 70453231
CID 70453231 (PubChem CID 70453231) has the molecular formula C17H15N5NaO4 and a molecular weight of 376.33 g/mol.
| Compound Name | CID 70453231 |
|---|---|
| PubChem CID | 70453231 |
| Molecular Formula | C17H15N5NaO4 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | — |
| SMILES | Cn1c(=O)c2c(nc3n(Cc4ccccc4)c(O)cc(=O)n23)n(C)c1=O.[Na] |
| InChI | InChI=1S/C17H15N5O4.Na/c1-19-14-13(15(25)20(2)17(19)26)22-12(24)8-11(23)21(16(22)18-14)9-10-6-4-3-5-7-10;/h3-8,23H,9H2,1-2H3; |
| InChIKey | KZSCPXJNDGDDNJ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |