C14H15N5O2 — CID 167483189
1,3,7-trimethyl-8-(6-methyl-3-pyridinyl)purine-2,6-dione (PubChem CID 167483189) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-(6-methyl-3-pyridinyl)purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-(6-methyl-3-pyridinyl)purine-2,6-dione |
|---|---|
| PubChem CID | 167483189 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1,3,7-trimethyl-8-(6-methyl-3-pyridinyl)purine-2,6-dione |
| SMILES | Cc1ccc(-c2nc3c(c(=O)n(C)c(=O)n3C)n2C)cn1 |
| InChI | InChI=1S/C14H15N5O2/c1-8-5-6-9(7-15-8)11-16-12-10(17(11)2)13(20)19(4)14(21)18(12)3/h5-7H,1-4H3 |
| InChIKey | SQPLISNGPNRDBZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 74.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |