C19H26ClN5O2 — CID 20562658
8-(4-chlorophenyl)-7-ethyl-1,3-dimethylpurine-2,6-dione;N-ethylethanamine (PubChem CID 20562658) has the molecular formula C19H26ClN5O2 and a molecular weight of 391.90 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-7-ethyl-1,3-dimethylpurine-2,6-dione;N-ethylethanamine.
| Compound Name | 8-(4-chlorophenyl)-7-ethyl-1,3-dimethylpurine-2,6-dione;N-ethylethanamine |
|---|---|
| PubChem CID | 20562658 |
| Molecular Formula | C19H26ClN5O2 |
| Molecular Weight | 391.90 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 8-(4-chlorophenyl)-7-ethyl-1,3-dimethylpurine-2,6-dione;N-ethylethanamine |
| SMILES | CCNCC.CCn1c(-c2ccc(Cl)cc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H15ClN4O2.C4H11N/c1-4-20-11-13(18(2)15(22)19(3)14(11)21)17-12(20)9-5-7-10(16)8-6-9;1-3-5-4-2/h5-8H,4H2,1-3H3;5H,3-4H2,1-2H3 |
| InChIKey | BTCJQVLUGRRHKK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.90 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |