C14H16N4O2S — CID 154715802
1,3-dimethyl-7-propyl-8-thiophen-3-ylpurine-2,6-dione (PubChem CID 154715802) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 1,3-dimethyl-7-propyl-8-thiophen-3-ylpurine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-propyl-8-thiophen-3-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 154715802 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1,3-dimethyl-7-propyl-8-thiophen-3-ylpurine-2,6-dione |
| SMILES | CCCn1c(-c2ccsc2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C14H16N4O2S/c1-4-6-18-10-12(15-11(18)9-5-7-21-8-9)16(2)14(20)17(3)13(10)19/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | IXFVLCUVGWEBAT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |