C14H13N4O5S- — CID 59749118
4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)benzenesulfonate (PubChem CID 59749118) has the molecular formula C14H13N4O5S- and a molecular weight of 349.35 g/mol. Its IUPAC name is 4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)benzenesulfonate.
| Compound Name | 4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)benzenesulfonate |
|---|---|
| PubChem CID | 59749118 |
| Molecular Formula | C14H13N4O5S- |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 4-(1,3,7-trimethyl-2,6-dioxopurin-8-yl)benzenesulfonate |
| SMILES | Cn1c(=O)c2c(nc(-c3ccc(S(=O)(=O)[O-])cc3)n2C)n(C)c1=O |
| InChI | InChI=1S/C14H14N4O5S/c1-16-10-12(17(2)14(20)18(3)13(10)19)15-11(16)8-4-6-9(7-5-8)24(21,22)23/h4-7H,1-3H3,(H,21,22,23)/p-1 |
| InChIKey | RCXJIEJBIXFCTK-UHFFFAOYSA-M |
| XLogP | -0.46 |
| TPSA | 119.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|