C17H16N4O2 — CID 89243440
3,7-dimethyl-8-(4-methylphenyl)-1-prop-2-ynylpurine-2,6-dione (PubChem CID 89243440) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 3,7-dimethyl-8-(4-methylphenyl)-1-prop-2-ynylpurine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-(4-methylphenyl)-1-prop-2-ynylpurine-2,6-dione |
|---|---|
| PubChem CID | 89243440 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3,7-dimethyl-8-(4-methylphenyl)-1-prop-2-ynylpurine-2,6-dione |
| SMILES | C#CCn1c(=O)c2c(nc(-c3ccc(C)cc3)n2C)n(C)c1=O |
| InChI | InChI=1S/C17H16N4O2/c1-5-10-21-16(22)13-15(20(4)17(21)23)18-14(19(13)3)12-8-6-11(2)7-9-12/h1,6-9H,10H2,2-4H3 |
| InChIKey | GJKYQVFZYTYIJQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|