About 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione
8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione (PubChem CID 88896689) has the molecular formula C17H16N4O3
and a molecular weight of 324.34 g/mol. Its IUPAC name is 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione.
Molecular Properties
| Compound Name | 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione |
| PubChem CID | 88896689 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione |
| SMILES | C#CCn1c(=O)c2c(nc(-c3ccccc3OC)n2C)n(C)c1=O |
| InChI | InChI=1S/C17H16N4O3/c1-5-10-21-16(22)13-15(20(3)17(21)23)18-14(19(13)2)11-8-6-7-9-12(11)24-4/h1,6-9H,10H2,2-4H3 |
| InChIKey | MXQPPFMGQAJBIZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione?
The IUPAC name of 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione (CID 88896689) is 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione.
What is the SMILES notation for 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione?
The canonical SMILES for 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione is C#CCn1c(=O)c2c(nc(-c3ccccc3OC)n2C)n(C)c1=O.
What is the InChIKey of 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione?
The InChIKey is MXQPPFMGQAJBIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O3/c1-5-10-21-16(22)13-15(20(3)17(21)23)18-14(19(13)2)11-8-6-7-9-12(11)24-4/h1,6-9H,10H2,2-4H3.
What are the key properties of 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione?
8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione has a molecular weight of 324.34 g/mol, XLogP of 0.74, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-methoxyphenyl)-3,7-dimethyl-1-prop-2-ynylpurine-2,6-dione is sourced from PubChem (CID 88896689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).