C20H15N5O3 — CID 25060615
2-[8-[2-(3-methoxyphenyl)ethynyl]-3-methyl-2,6-dioxo-1-prop-2-ynylpurin-7-yl]acetonitrile (PubChem CID 25060615) has the molecular formula C20H15N5O3 and a molecular weight of 373.37 g/mol. Its IUPAC name is 2-[8-[2-(3-methoxyphenyl)ethynyl]-3-methyl-2,6-dioxo-1-prop-2-ynylpurin-7-yl]acetonitrile.
| Compound Name | 2-[8-[2-(3-methoxyphenyl)ethynyl]-3-methyl-2,6-dioxo-1-prop-2-ynylpurin-7-yl]acetonitrile |
|---|---|
| PubChem CID | 25060615 |
| Molecular Formula | C20H15N5O3 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[8-[2-(3-methoxyphenyl)ethynyl]-3-methyl-2,6-dioxo-1-prop-2-ynylpurin-7-yl]acetonitrile |
| SMILES | C#CCn1c(=O)c2c(nc(C#Cc3cccc(OC)c3)n2CC#N)n(C)c1=O |
| InChI | InChI=1S/C20H15N5O3/c1-4-11-25-19(26)17-18(23(2)20(25)27)22-16(24(17)12-10-21)9-8-14-6-5-7-15(13-14)28-3/h1,5-7,13H,11-12H2,2-3H3 |
| InChIKey | SMOLILXXCAZPGH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 94.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|