C23H22N4O4 — CID 143705663
8-[2-(4-ethenoxy-3-ethoxyphenyl)ethynyl]-3-ethyl-7-methyl-1-prop-2-ynylpurine-2,6-dione (PubChem CID 143705663) has the molecular formula C23H22N4O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 8-[2-(4-ethenoxy-3-ethoxyphenyl)ethynyl]-3-ethyl-7-methyl-1-prop-2-ynylpurine-2,6-dione.
| Compound Name | 8-[2-(4-ethenoxy-3-ethoxyphenyl)ethynyl]-3-ethyl-7-methyl-1-prop-2-ynylpurine-2,6-dione |
|---|---|
| PubChem CID | 143705663 |
| Molecular Formula | C23H22N4O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 8-[2-(4-ethenoxy-3-ethoxyphenyl)ethynyl]-3-ethyl-7-methyl-1-prop-2-ynylpurine-2,6-dione |
| SMILES | C#CCn1c(=O)c2c(nc(C#Cc3ccc(OC=C)c(OCC)c3)n2C)n(CC)c1=O |
| InChI | InChI=1S/C23H22N4O4/c1-6-14-27-22(28)20-21(26(7-2)23(27)29)24-19(25(20)5)13-11-16-10-12-17(30-8-3)18(15-16)31-9-4/h1,8,10,12,15H,3,7,9,14H2,2,4-5H3 |
| InChIKey | KFQKDVXIDGYJHT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|